C18H12F3N3O5 — CID 8785087
[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 4-oxo-3H-phthalazine-1-carboxylate (PubChem CID 8785087) has the molecular formula C18H12F3N3O5 and a molecular weight of 407.30 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 4-oxo-3H-phthalazine-1-carboxylate.
| Compound Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 4-oxo-3H-phthalazine-1-carboxylate |
|---|---|
| PubChem CID | 8785087 |
| Molecular Formula | C18H12F3N3O5 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 4-oxo-3H-phthalazine-1-carboxylate |
| SMILES | O=C(COC(=O)c1n[nH]c(=O)c2ccccc12)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H12F3N3O5/c19-18(20,21)29-11-7-5-10(6-8-11)22-14(25)9-28-17(27)15-12-3-1-2-4-13(12)16(26)24-23-15/h1-8H,9H2,(H,22,25)(H,24,26) |
| InChIKey | CZRWWYUGDYOTMV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |