C18H15F3N4O3 — CID 9070389
N-methyl-N-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]-1H-indazole-3-carboxamide (PubChem CID 9070389) has the molecular formula C18H15F3N4O3 and a molecular weight of 392.34 g/mol. Its IUPAC name is N-methyl-N-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]-1H-indazole-3-carboxamide.
| Compound Name | N-methyl-N-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 9070389 |
| Molecular Formula | C18H15F3N4O3 |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | N-methyl-N-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]-1H-indazole-3-carboxamide |
| SMILES | CN(CC(=O)Nc1ccc(OC(F)(F)F)cc1)C(=O)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C18H15F3N4O3/c1-25(17(27)16-13-4-2-3-5-14(13)23-24-16)10-15(26)22-11-6-8-12(9-7-11)28-18(19,20)21/h2-9H,10H2,1H3,(H,22,26)(H,23,24) |
| InChIKey | TYISBOWEYQSDCL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |