C16H14Cl3NO3 — CID 7275215
N-(2-methoxy-5-methylphenyl)-2-(2,4,6-trichlorophenoxy)acetamide (PubChem CID 7275215) has the molecular formula C16H14Cl3NO3 and a molecular weight of 374.65 g/mol. Its IUPAC name is N-(2-methoxy-5-methylphenyl)-2-(2,4,6-trichlorophenoxy)acetamide.
| Compound Name | N-(2-methoxy-5-methylphenyl)-2-(2,4,6-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 7275215 |
| Molecular Formula | C16H14Cl3NO3 |
| Molecular Weight | 374.65 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | N-(2-methoxy-5-methylphenyl)-2-(2,4,6-trichlorophenoxy)acetamide |
| SMILES | COc1ccc(C)cc1NC(=O)COc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C16H14Cl3NO3/c1-9-3-4-14(22-2)13(5-9)20-15(21)8-23-16-11(18)6-10(17)7-12(16)19/h3-7H,8H2,1-2H3,(H,20,21) |
| InChIKey | QGCCJFMUBKUEMA-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.65 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |