C19H20ClNO5 — CID 28913481
2-(2-chloro-6-ethoxy-4-formylphenoxy)-N-(2-methoxy-5-methylphenyl)acetamide (PubChem CID 28913481) has the molecular formula C19H20ClNO5 and a molecular weight of 377.82 g/mol. Its IUPAC name is 2-(2-chloro-6-ethoxy-4-formylphenoxy)-N-(2-methoxy-5-methylphenyl)acetamide.
| Compound Name | 2-(2-chloro-6-ethoxy-4-formylphenoxy)-N-(2-methoxy-5-methylphenyl)acetamide |
|---|---|
| PubChem CID | 28913481 |
| Molecular Formula | C19H20ClNO5 |
| Molecular Weight | 377.82 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 2-(2-chloro-6-ethoxy-4-formylphenoxy)-N-(2-methoxy-5-methylphenyl)acetamide |
| SMILES | CCOc1cc(C=O)cc(Cl)c1OCC(=O)Nc1cc(C)ccc1OC |
| InChI | InChI=1S/C19H20ClNO5/c1-4-25-17-9-13(10-22)8-14(20)19(17)26-11-18(23)21-15-7-12(2)5-6-16(15)24-3/h5-10H,4,11H2,1-3H3,(H,21,23) |
| InChIKey | KRGFFUBBBQPYEZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.82 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|