C19H19Cl3N2O2 — CID 4043146
N-(3-chloro-4-pyrrolidin-1-ylphenyl)-2-(2,4-dichloro-6-methylphenoxy)acetamide (PubChem CID 4043146) has the molecular formula C19H19Cl3N2O2 and a molecular weight of 413.73 g/mol. Its IUPAC name is N-(3-chloro-4-pyrrolidin-1-ylphenyl)-2-(2,4-dichloro-6-methylphenoxy)acetamide.
| Compound Name | N-(3-chloro-4-pyrrolidin-1-ylphenyl)-2-(2,4-dichloro-6-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 4043146 |
| Molecular Formula | C19H19Cl3N2O2 |
| Molecular Weight | 413.73 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | N-(3-chloro-4-pyrrolidin-1-ylphenyl)-2-(2,4-dichloro-6-methylphenoxy)acetamide |
| SMILES | Cc1cc(Cl)cc(Cl)c1OCC(=O)Nc1ccc(N2CCCC2)c(Cl)c1 |
| InChI | InChI=1S/C19H19Cl3N2O2/c1-12-8-13(20)9-16(22)19(12)26-11-18(25)23-14-4-5-17(15(21)10-14)24-6-2-3-7-24/h4-5,8-10H,2-3,6-7,11H2,1H3,(H,23,25) |
| InChIKey | JNKFNBDUDMHEAT-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.73 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|