C21H20ClNO5 — CID 41350294
2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-[2-(4-methoxyphenyl)ethyl]acetamide (PubChem CID 41350294) has the molecular formula C21H20ClNO5 and a molecular weight of 401.85 g/mol. Its IUPAC name is 2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-[2-(4-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-[2-(4-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 41350294 |
| Molecular Formula | C21H20ClNO5 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-[2-(4-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc(CCNC(=O)COc2cc3oc(=O)cc(C)c3cc2Cl)cc1 |
| InChI | InChI=1S/C21H20ClNO5/c1-13-9-21(25)28-18-11-19(17(22)10-16(13)18)27-12-20(24)23-8-7-14-3-5-15(26-2)6-4-14/h3-6,9-11H,7-8,12H2,1-2H3,(H,23,24) |
| InChIKey | KTWJQESTDKSENM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|