C20H21NO6 — CID 40816601
2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)-N-[(2R)-4-(furan-2-yl)butan-2-yl]acetamide (PubChem CID 40816601) has the molecular formula C20H21NO6 and a molecular weight of 371.39 g/mol. Its IUPAC name is 2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)-N-[(2R)-4-(furan-2-yl)butan-2-yl]acetamide.
| Compound Name | 2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)-N-[(2R)-4-(furan-2-yl)butan-2-yl]acetamide |
|---|---|
| PubChem CID | 40816601 |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)-N-[(2R)-4-(furan-2-yl)butan-2-yl]acetamide |
| SMILES | Cc1c(CC(=O)N[C@H](C)CCc2ccco2)c(=O)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C20H21NO6/c1-11(5-6-14-4-3-7-26-14)21-18(24)10-15-12(2)19-16(23)8-13(22)9-17(19)27-20(15)25/h3-4,7-9,11,22-23H,5-6,10H2,1-2H3,(H,21,24)/t11-/m1/s1 |
| InChIKey | VXFONQUXTJKLNW-LLVKDONJSA-N |
| XLogP | 2.79 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|