C22H18FNO4 — CID 4967951
N-(2-fluorophenyl)-2-(3,4,9-trimethyl-7-oxofuro[2,3-f]chromen-8-yl)acetamide (PubChem CID 4967951) has the molecular formula C22H18FNO4 and a molecular weight of 379.39 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-(3,4,9-trimethyl-7-oxofuro[2,3-f]chromen-8-yl)acetamide.
| Compound Name | N-(2-fluorophenyl)-2-(3,4,9-trimethyl-7-oxofuro[2,3-f]chromen-8-yl)acetamide |
|---|---|
| PubChem CID | 4967951 |
| Molecular Formula | C22H18FNO4 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | N-(2-fluorophenyl)-2-(3,4,9-trimethyl-7-oxofuro[2,3-f]chromen-8-yl)acetamide |
| SMILES | Cc1coc2c1c(C)cc1oc(=O)c(CC(=O)Nc3ccccc3F)c(C)c12 |
| InChI | InChI=1S/C22H18FNO4/c1-11-8-17-20(21-19(11)12(2)10-27-21)13(3)14(22(26)28-17)9-18(25)24-16-7-5-4-6-15(16)23/h4-8,10H,9H2,1-3H3,(H,24,25) |
| InChIKey | VJCGSPVVAISOIX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|