C26H25NO6S — CID 41062251
2-(4,9-dimethyl-7-oxo-3-phenylfuro[2,3-f]chromen-8-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylacetamide (PubChem CID 41062251) has the molecular formula C26H25NO6S and a molecular weight of 479.55 g/mol. Its IUPAC name is 2-(4,9-dimethyl-7-oxo-3-phenylfuro[2,3-f]chromen-8-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylacetamide.
| Compound Name | 2-(4,9-dimethyl-7-oxo-3-phenylfuro[2,3-f]chromen-8-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 41062251 |
| Molecular Formula | C26H25NO6S |
| Molecular Weight | 479.55 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 2-(4,9-dimethyl-7-oxo-3-phenylfuro[2,3-f]chromen-8-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylacetamide |
| SMILES | Cc1cc2oc(=O)c(CC(=O)N(C)[C@@H]3CCS(=O)(=O)C3)c(C)c2c2occ(-c3ccccc3)c12 |
| InChI | InChI=1S/C26H25NO6S/c1-15-11-21-24(25-23(15)20(13-32-25)17-7-5-4-6-8-17)16(2)19(26(29)33-21)12-22(28)27(3)18-9-10-34(30,31)14-18/h4-8,11,13,18H,9-10,12,14H2,1-3H3/t18-/m1/s1 |
| InChIKey | LYCRNIWXJDSGTL-GOSISDBHSA-N |
| XLogP | 4.01 |
| TPSA | 97.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|