C19H23NO7S — CID 40918188
2-(5,7-dimethoxy-4-methyl-2-oxochromen-3-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylacetamide (PubChem CID 40918188) has the molecular formula C19H23NO7S and a molecular weight of 409.46 g/mol. Its IUPAC name is 2-(5,7-dimethoxy-4-methyl-2-oxochromen-3-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylacetamide.
| Compound Name | 2-(5,7-dimethoxy-4-methyl-2-oxochromen-3-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 40918188 |
| Molecular Formula | C19H23NO7S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 2-(5,7-dimethoxy-4-methyl-2-oxochromen-3-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylacetamide |
| SMILES | COc1cc(OC)c2c(C)c(CC(=O)N(C)[C@@H]3CCS(=O)(=O)C3)c(=O)oc2c1 |
| InChI | InChI=1S/C19H23NO7S/c1-11-14(9-17(21)20(2)12-5-6-28(23,24)10-12)19(22)27-16-8-13(25-3)7-15(26-4)18(11)16/h7-8,12H,5-6,9-10H2,1-4H3/t12-/m1/s1 |
| InChIKey | HDEHURBABWKWLW-GFCCVEGCSA-N |
| XLogP | 1.31 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|