C18H21NO6S — CID 40947046
N-[(3S)-1,1-dioxothiolan-3-yl]-3-(7-hydroxy-4-methyl-2-oxochromen-3-yl)-N-methylpropanamide (PubChem CID 40947046) has the molecular formula C18H21NO6S and a molecular weight of 379.43 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-3-(7-hydroxy-4-methyl-2-oxochromen-3-yl)-N-methylpropanamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-3-(7-hydroxy-4-methyl-2-oxochromen-3-yl)-N-methylpropanamide |
|---|---|
| PubChem CID | 40947046 |
| Molecular Formula | C18H21NO6S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-3-(7-hydroxy-4-methyl-2-oxochromen-3-yl)-N-methylpropanamide |
| SMILES | Cc1c(CCC(=O)N(C)[C@H]2CCS(=O)(=O)C2)c(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C18H21NO6S/c1-11-14-4-3-13(20)9-16(14)25-18(22)15(11)5-6-17(21)19(2)12-7-8-26(23,24)10-12/h3-4,9,12,20H,5-8,10H2,1-2H3/t12-/m0/s1 |
| InChIKey | GCGZYEGIYGMUSA-LBPRGKRZSA-N |
| XLogP | 1.39 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|