C24H23NO5 — CID 7096783
N-[(2R)-2-hydroxy-2-phenylethyl]-2-(3,4,9-trimethyl-7-oxofuro[2,3-f]chromen-8-yl)acetamide (PubChem CID 7096783) has the molecular formula C24H23NO5 and a molecular weight of 405.45 g/mol. Its IUPAC name is N-[(2R)-2-hydroxy-2-phenylethyl]-2-(3,4,9-trimethyl-7-oxofuro[2,3-f]chromen-8-yl)acetamide.
| Compound Name | N-[(2R)-2-hydroxy-2-phenylethyl]-2-(3,4,9-trimethyl-7-oxofuro[2,3-f]chromen-8-yl)acetamide |
|---|---|
| PubChem CID | 7096783 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | N-[(2R)-2-hydroxy-2-phenylethyl]-2-(3,4,9-trimethyl-7-oxofuro[2,3-f]chromen-8-yl)acetamide |
| SMILES | Cc1coc2c1c(C)cc1oc(=O)c(CC(=O)NC[C@H](O)c3ccccc3)c(C)c12 |
| InChI | InChI=1S/C24H23NO5/c1-13-9-19-22(23-21(13)14(2)12-29-23)15(3)17(24(28)30-19)10-20(27)25-11-18(26)16-7-5-4-6-8-16/h4-9,12,18,26H,10-11H2,1-3H3,(H,25,27)/t18-/m0/s1 |
| InChIKey | TVDYYMBPWNVQOC-SFHVURJKSA-N |
| XLogP | 3.86 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|