C26H28N2O4 — CID 4869458
N-[3-(dimethylamino)propyl]-2-(4,9-dimethyl-7-oxo-3-phenylfuro[2,3-f]chromen-8-yl)acetamide (PubChem CID 4869458) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-(4,9-dimethyl-7-oxo-3-phenylfuro[2,3-f]chromen-8-yl)acetamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2-(4,9-dimethyl-7-oxo-3-phenylfuro[2,3-f]chromen-8-yl)acetamide |
|---|---|
| PubChem CID | 4869458 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-(4,9-dimethyl-7-oxo-3-phenylfuro[2,3-f]chromen-8-yl)acetamide |
| SMILES | Cc1cc2oc(=O)c(CC(=O)NCCCN(C)C)c(C)c2c2occ(-c3ccccc3)c12 |
| InChI | InChI=1S/C26H28N2O4/c1-16-13-21-24(25-23(16)20(15-31-25)18-9-6-5-7-10-18)17(2)19(26(30)32-21)14-22(29)27-11-8-12-28(3)4/h5-7,9-10,13,15H,8,11-12,14H2,1-4H3,(H,27,29) |
| InChIKey | NCDPXMHLETUKJD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 75.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|