C25H25NO4 — CID 4869284
N-(3-phenylpropyl)-2-(3,4,9-trimethyl-7-oxofuro[2,3-f]chromen-8-yl)acetamide (PubChem CID 4869284) has the molecular formula C25H25NO4 and a molecular weight of 403.48 g/mol. Its IUPAC name is N-(3-phenylpropyl)-2-(3,4,9-trimethyl-7-oxofuro[2,3-f]chromen-8-yl)acetamide.
| Compound Name | N-(3-phenylpropyl)-2-(3,4,9-trimethyl-7-oxofuro[2,3-f]chromen-8-yl)acetamide |
|---|---|
| PubChem CID | 4869284 |
| Molecular Formula | C25H25NO4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | N-(3-phenylpropyl)-2-(3,4,9-trimethyl-7-oxofuro[2,3-f]chromen-8-yl)acetamide |
| SMILES | Cc1coc2c1c(C)cc1oc(=O)c(CC(=O)NCCCc3ccccc3)c(C)c12 |
| InChI | InChI=1S/C25H25NO4/c1-15-12-20-23(24-22(15)16(2)14-29-24)17(3)19(25(28)30-20)13-21(27)26-11-7-10-18-8-5-4-6-9-18/h4-6,8-9,12,14H,7,10-11,13H2,1-3H3,(H,26,27) |
| InChIKey | BSYRUSYOAJUEFV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|