C18H24N2O — CID 110773689
N-(3-phenylpropyl)-2-(1,2,5-trimethylpyrrol-3-yl)acetamide (PubChem CID 110773689) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is N-(3-phenylpropyl)-2-(1,2,5-trimethylpyrrol-3-yl)acetamide.
| Compound Name | N-(3-phenylpropyl)-2-(1,2,5-trimethylpyrrol-3-yl)acetamide |
|---|---|
| PubChem CID | 110773689 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | N-(3-phenylpropyl)-2-(1,2,5-trimethylpyrrol-3-yl)acetamide |
| SMILES | Cc1cc(CC(=O)NCCCc2ccccc2)c(C)n1C |
| InChI | InChI=1S/C18H24N2O/c1-14-12-17(15(2)20(14)3)13-18(21)19-11-7-10-16-8-5-4-6-9-16/h4-6,8-9,12H,7,10-11,13H2,1-3H3,(H,19,21) |
| InChIKey | GAEWLWIRZYSDSS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|