C20H17ClFNO5 — CID 4973849
N-(3-chloro-4-fluorophenyl)-2-(7,8-dimethoxy-4-methyl-2-oxochromen-3-yl)acetamide (PubChem CID 4973849) has the molecular formula C20H17ClFNO5 and a molecular weight of 405.81 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-(7,8-dimethoxy-4-methyl-2-oxochromen-3-yl)acetamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-(7,8-dimethoxy-4-methyl-2-oxochromen-3-yl)acetamide |
|---|---|
| PubChem CID | 4973849 |
| Molecular Formula | C20H17ClFNO5 |
| Molecular Weight | 405.81 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-(7,8-dimethoxy-4-methyl-2-oxochromen-3-yl)acetamide |
| SMILES | COc1ccc2c(C)c(CC(=O)Nc3ccc(F)c(Cl)c3)c(=O)oc2c1OC |
| InChI | InChI=1S/C20H17ClFNO5/c1-10-12-5-7-16(26-2)19(27-3)18(12)28-20(25)13(10)9-17(24)23-11-4-6-15(22)14(21)8-11/h4-8H,9H2,1-3H3,(H,23,24) |
| InChIKey | LSVISVSBZNMMOO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.81 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|