C23H19NO6 — CID 71584136
3-[[2-(2,3,5-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]amino]benzoic acid (PubChem CID 71584136) has the molecular formula C23H19NO6 and a molecular weight of 405.41 g/mol. Its IUPAC name is 3-[[2-(2,3,5-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]amino]benzoic acid.
| Compound Name | 3-[[2-(2,3,5-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 71584136 |
| Molecular Formula | C23H19NO6 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 3-[[2-(2,3,5-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]amino]benzoic acid |
| SMILES | Cc1oc2cc3oc(=O)c(CC(=O)Nc4cccc(C(=O)O)c4)c(C)c3cc2c1C |
| InChI | InChI=1S/C23H19NO6/c1-11-13(3)29-19-10-20-17(8-16(11)19)12(2)18(23(28)30-20)9-21(25)24-15-6-4-5-14(7-15)22(26)27/h4-8,10H,9H2,1-3H3,(H,24,25)(H,26,27) |
| InChIKey | JOTIDCBZJKCENR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|