C30H26N2O8 — CID 95374185
(2S)-3-(5-hydroxy-1H-indol-3-yl)-2-[[(2R)-2-[3-(4-methoxyphenyl)-2-oxochromen-7-yl]oxypropanoyl]amino]propanoic acid (PubChem CID 95374185) has the molecular formula C30H26N2O8 and a molecular weight of 542.54 g/mol. Its IUPAC name is (2S)-3-(5-hydroxy-1H-indol-3-yl)-2-[[(2R)-2-[3-(4-methoxyphenyl)-2-oxochromen-7-yl]oxypropanoyl]amino]propanoic acid.
| Compound Name | (2S)-3-(5-hydroxy-1H-indol-3-yl)-2-[[(2R)-2-[3-(4-methoxyphenyl)-2-oxochromen-7-yl]oxypropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 95374185 |
| Molecular Formula | C30H26N2O8 |
| Molecular Weight | 542.54 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | (2S)-3-(5-hydroxy-1H-indol-3-yl)-2-[[(2R)-2-[3-(4-methoxyphenyl)-2-oxochromen-7-yl]oxypropanoyl]amino]propanoic acid |
| SMILES | COc1ccc(-c2cc3ccc(O[C@H](C)C(=O)N[C@@H](Cc4c[nH]c5ccc(O)cc45)C(=O)O)cc3oc2=O)cc1 |
| InChI | InChI=1S/C30H26N2O8/c1-16(28(34)32-26(29(35)36)12-19-15-31-25-10-6-20(33)13-23(19)25)39-22-9-5-18-11-24(30(37)40-27(18)14-22)17-3-7-21(38-2)8-4-17/h3-11,13-16,26,31,33H,12H2,1-2H3,(H,32,34)(H,35,36)/t16-,26+/m1/s1 |
| InChIKey | BOCBRLLDLHHWBP-DXPJPUQTSA-N |
| XLogP | 4.23 |
| TPSA | 151.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|