C25H24N2O6 — CID 163358668
(2R)-2-[2-(3,4-dimethyl-2-oxochromen-7-yl)oxypropanoylamino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 163358668) has the molecular formula C25H24N2O6 and a molecular weight of 448.48 g/mol. Its IUPAC name is (2R)-2-[2-(3,4-dimethyl-2-oxochromen-7-yl)oxypropanoylamino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2R)-2-[2-(3,4-dimethyl-2-oxochromen-7-yl)oxypropanoylamino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 163358668 |
| Molecular Formula | C25H24N2O6 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | (2R)-2-[2-(3,4-dimethyl-2-oxochromen-7-yl)oxypropanoylamino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | Cc1c(C)c2ccc(OC(C)C(=O)N[C@H](Cc3c[nH]c4ccccc34)C(=O)O)cc2oc1=O |
| InChI | InChI=1S/C25H24N2O6/c1-13-14(2)25(31)33-22-11-17(8-9-18(13)22)32-15(3)23(28)27-21(24(29)30)10-16-12-26-20-7-5-4-6-19(16)20/h4-9,11-12,15,21,26H,10H2,1-3H3,(H,27,28)(H,29,30)/t15?,21-/m1/s1 |
| InChIKey | KKNOFXFXJSMTPD-MZVUKIKXSA-N |
| XLogP | 3.47 |
| TPSA | 121.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|