C24H24FNO3 — CID 18164949
N-cyclopropyl-3-(4,7-dimethyl-2-oxochromen-3-yl)-N-[(4-fluorophenyl)methyl]propanamide (PubChem CID 18164949) has the molecular formula C24H24FNO3 and a molecular weight of 393.46 g/mol. Its IUPAC name is N-cyclopropyl-3-(4,7-dimethyl-2-oxochromen-3-yl)-N-[(4-fluorophenyl)methyl]propanamide.
| Compound Name | N-cyclopropyl-3-(4,7-dimethyl-2-oxochromen-3-yl)-N-[(4-fluorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 18164949 |
| Molecular Formula | C24H24FNO3 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-cyclopropyl-3-(4,7-dimethyl-2-oxochromen-3-yl)-N-[(4-fluorophenyl)methyl]propanamide |
| SMILES | Cc1ccc2c(C)c(CCC(=O)N(Cc3ccc(F)cc3)C3CC3)c(=O)oc2c1 |
| InChI | InChI=1S/C24H24FNO3/c1-15-3-10-20-16(2)21(24(28)29-22(20)13-15)11-12-23(27)26(19-8-9-19)14-17-4-6-18(25)7-5-17/h3-7,10,13,19H,8-9,11-12,14H2,1-2H3 |
| InChIKey | PBGNJTIJAHWBRQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|