C16H14N2O4S — CID 87181337
N-[4-[(7-hydroxy-4-methyl-2-oxochromen-3-yl)methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 87181337) has the molecular formula C16H14N2O4S and a molecular weight of 330.37 g/mol. Its IUPAC name is N-[4-[(7-hydroxy-4-methyl-2-oxochromen-3-yl)methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[4-[(7-hydroxy-4-methyl-2-oxochromen-3-yl)methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 87181337 |
| Molecular Formula | C16H14N2O4S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | N-[4-[(7-hydroxy-4-methyl-2-oxochromen-3-yl)methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(Cc2c(C)c3ccc(O)cc3oc2=O)cs1 |
| InChI | InChI=1S/C16H14N2O4S/c1-8-12-4-3-11(20)6-14(12)22-15(21)13(8)5-10-7-23-16(18-10)17-9(2)19/h3-4,6-7,20H,5H2,1-2H3,(H,17,18,19) |
| InChIKey | YIMSDZMSTUGVFO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|