C24H32N2O6 — CID 24677365
4-hexoxy-N'-[2-(3,4,5-trimethoxyphenyl)acetyl]benzohydrazide (PubChem CID 24677365) has the molecular formula C24H32N2O6 and a molecular weight of 444.53 g/mol. Its IUPAC name is 4-hexoxy-N'-[2-(3,4,5-trimethoxyphenyl)acetyl]benzohydrazide.
| Compound Name | 4-hexoxy-N'-[2-(3,4,5-trimethoxyphenyl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 24677365 |
| Molecular Formula | C24H32N2O6 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 4-hexoxy-N'-[2-(3,4,5-trimethoxyphenyl)acetyl]benzohydrazide |
| SMILES | CCCCCCOc1ccc(C(=O)NNC(=O)Cc2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C24H32N2O6/c1-5-6-7-8-13-32-19-11-9-18(10-12-19)24(28)26-25-22(27)16-17-14-20(29-2)23(31-4)21(15-17)30-3/h9-12,14-15H,5-8,13,16H2,1-4H3,(H,25,27)(H,26,28) |
| InChIKey | SUGBLPQTRQYZAN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|