C16H15Cl2NO5S — CID 6456736
N-(1,3-benzodioxol-5-ylmethyl)-2,5-dichloro-4-ethoxybenzenesulfonamide (PubChem CID 6456736) has the molecular formula C16H15Cl2NO5S and a molecular weight of 404.27 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2,5-dichloro-4-ethoxybenzenesulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2,5-dichloro-4-ethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 6456736 |
| Molecular Formula | C16H15Cl2NO5S |
| Molecular Weight | 404.27 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2,5-dichloro-4-ethoxybenzenesulfonamide |
| SMILES | CCOc1cc(Cl)c(S(=O)(=O)NCc2ccc3c(c2)OCO3)cc1Cl |
| InChI | InChI=1S/C16H15Cl2NO5S/c1-2-22-14-6-12(18)16(7-11(14)17)25(20,21)19-8-10-3-4-13-15(5-10)24-9-23-13/h3-7,19H,2,8-9H2,1H3 |
| InChIKey | KOCNFZBSJAJMIP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.27 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |