C17H16N4O4S2 — CID 133299763
N-methyl-3-nitro-4-[[phenyl(1,3-thiazol-2-yl)methyl]amino]benzenesulfonamide (PubChem CID 133299763) has the molecular formula C17H16N4O4S2 and a molecular weight of 404.47 g/mol. Its IUPAC name is N-methyl-3-nitro-4-[[phenyl(1,3-thiazol-2-yl)methyl]amino]benzenesulfonamide.
| Compound Name | N-methyl-3-nitro-4-[[phenyl(1,3-thiazol-2-yl)methyl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 133299763 |
| Molecular Formula | C17H16N4O4S2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | N-methyl-3-nitro-4-[[phenyl(1,3-thiazol-2-yl)methyl]amino]benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(NC(c2ccccc2)c2nccs2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16N4O4S2/c1-18-27(24,25)13-7-8-14(15(11-13)21(22)23)20-16(17-19-9-10-26-17)12-5-3-2-4-6-12/h2-11,16,18,20H,1H3 |
| InChIKey | FUGUVPICMXNQSA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|