C17H15N3O2S — CID 133299712
3-methyl-4-nitro-N-[phenyl(1,3-thiazol-2-yl)methyl]aniline (PubChem CID 133299712) has the molecular formula C17H15N3O2S and a molecular weight of 325.39 g/mol. Its IUPAC name is 3-methyl-4-nitro-N-[phenyl(1,3-thiazol-2-yl)methyl]aniline.
| Compound Name | 3-methyl-4-nitro-N-[phenyl(1,3-thiazol-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 133299712 |
| Molecular Formula | C17H15N3O2S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 3-methyl-4-nitro-N-[phenyl(1,3-thiazol-2-yl)methyl]aniline |
| SMILES | Cc1cc(NC(c2ccccc2)c2nccs2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H15N3O2S/c1-12-11-14(7-8-15(12)20(21)22)19-16(17-18-9-10-23-17)13-5-3-2-4-6-13/h2-11,16,19H,1H3 |
| InChIKey | XQVJPKDLRFMUTC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|