C15H14N4S — CID 133470230
6-methyl-N-[phenyl(1,3-thiazol-2-yl)methyl]pyrazin-2-amine (PubChem CID 133470230) has the molecular formula C15H14N4S and a molecular weight of 282.37 g/mol. Its IUPAC name is 6-methyl-N-[phenyl(1,3-thiazol-2-yl)methyl]pyrazin-2-amine.
| Compound Name | 6-methyl-N-[phenyl(1,3-thiazol-2-yl)methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 133470230 |
| Molecular Formula | C15H14N4S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 6-methyl-N-[phenyl(1,3-thiazol-2-yl)methyl]pyrazin-2-amine |
| SMILES | Cc1cncc(NC(c2ccccc2)c2nccs2)n1 |
| InChI | InChI=1S/C15H14N4S/c1-11-9-16-10-13(18-11)19-14(15-17-7-8-20-15)12-5-3-2-4-6-12/h2-10,14H,1H3,(H,18,19) |
| InChIKey | GXURFKVKTNFKBT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |