C14H12N6O2S — CID 133299726
5-nitro-2-N-[phenyl(1,3-thiazol-2-yl)methyl]pyrimidine-2,4-diamine (PubChem CID 133299726) has the molecular formula C14H12N6O2S and a molecular weight of 328.36 g/mol. Its IUPAC name is 5-nitro-2-N-[phenyl(1,3-thiazol-2-yl)methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-nitro-2-N-[phenyl(1,3-thiazol-2-yl)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 133299726 |
| Molecular Formula | C14H12N6O2S |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 5-nitro-2-N-[phenyl(1,3-thiazol-2-yl)methyl]pyrimidine-2,4-diamine |
| SMILES | Nc1nc(NC(c2ccccc2)c2nccs2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H12N6O2S/c15-12-10(20(21)22)8-17-14(19-12)18-11(13-16-6-7-23-13)9-4-2-1-3-5-9/h1-8,11H,(H3,15,17,18,19) |
| InChIKey | ZWCPYSMVKHJWIG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 119.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|