C15H17N5O4 — CID 122064259
4-[(4-amino-5-nitropyrimidin-2-yl)amino]-5-phenylpentanoic acid (PubChem CID 122064259) has the molecular formula C15H17N5O4 and a molecular weight of 331.33 g/mol. Its IUPAC name is 4-[(4-amino-5-nitropyrimidin-2-yl)amino]-5-phenylpentanoic acid.
| Compound Name | 4-[(4-amino-5-nitropyrimidin-2-yl)amino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122064259 |
| Molecular Formula | C15H17N5O4 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 4-[(4-amino-5-nitropyrimidin-2-yl)amino]-5-phenylpentanoic acid |
| SMILES | Nc1nc(NC(CCC(=O)O)Cc2ccccc2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17N5O4/c16-14-12(20(23)24)9-17-15(19-14)18-11(6-7-13(21)22)8-10-4-2-1-3-5-10/h1-5,9,11H,6-8H2,(H,21,22)(H3,16,17,18,19) |
| InChIKey | RIPVSSHJYRPJGO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|