C14H11FN4S — CID 141147891
N-[(4-fluorophenyl)-(1,3-thiazol-2-yl)methyl]pyrimidin-2-amine (PubChem CID 141147891) has the molecular formula C14H11FN4S and a molecular weight of 286.34 g/mol. Its IUPAC name is N-[(4-fluorophenyl)-(1,3-thiazol-2-yl)methyl]pyrimidin-2-amine.
| Compound Name | N-[(4-fluorophenyl)-(1,3-thiazol-2-yl)methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 141147891 |
| Molecular Formula | C14H11FN4S |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | N-[(4-fluorophenyl)-(1,3-thiazol-2-yl)methyl]pyrimidin-2-amine |
| SMILES | Fc1ccc(C(Nc2ncccn2)c2nccs2)cc1 |
| InChI | InChI=1S/C14H11FN4S/c15-11-4-2-10(3-5-11)12(13-16-8-9-20-13)19-14-17-6-1-7-18-14/h1-9,12H,(H,17,18,19) |
| InChIKey | KQEBAABWLFTVAK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |