C14H18N2S — CID 124570142
(2R)-N-[(S)-phenyl(1,3-thiazol-2-yl)methyl]butan-2-amine (PubChem CID 124570142) has the molecular formula C14H18N2S and a molecular weight of 246.38 g/mol. Its IUPAC name is (2R)-N-[(S)-phenyl(1,3-thiazol-2-yl)methyl]butan-2-amine.
| Compound Name | (2R)-N-[(S)-phenyl(1,3-thiazol-2-yl)methyl]butan-2-amine |
|---|---|
| PubChem CID | 124570142 |
| Molecular Formula | C14H18N2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | (2R)-N-[(S)-phenyl(1,3-thiazol-2-yl)methyl]butan-2-amine |
| SMILES | CC[C@@H](C)N[C@@H](c1ccccc1)c1nccs1 |
| InChI | InChI=1S/C14H18N2S/c1-3-11(2)16-13(14-15-9-10-17-14)12-7-5-4-6-8-12/h4-11,13,16H,3H2,1-2H3/t11-,13+/m1/s1 |
| InChIKey | IDMAVXXRWCOFBM-YPMHNXCESA-N |
| XLogP | 3.62 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |