C16H16N4O4S — CID 133333201
4-[1-(3-cyanophenyl)ethylamino]-N-methyl-3-nitrobenzenesulfonamide (PubChem CID 133333201) has the molecular formula C16H16N4O4S and a molecular weight of 360.40 g/mol. Its IUPAC name is 4-[1-(3-cyanophenyl)ethylamino]-N-methyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-[1-(3-cyanophenyl)ethylamino]-N-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 133333201 |
| Molecular Formula | C16H16N4O4S |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 4-[1-(3-cyanophenyl)ethylamino]-N-methyl-3-nitrobenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(NC(C)c2cccc(C#N)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H16N4O4S/c1-11(13-5-3-4-12(8-13)10-17)19-15-7-6-14(25(23,24)18-2)9-16(15)20(21)22/h3-9,11,18-19H,1-2H3 |
| InChIKey | KSEYWVPTRGIQIG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 125.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|