C20H18F3N3O4S — CID 46569284
N-[(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-4-(trifluoromethylsulfonyl)benzamide (PubChem CID 46569284) has the molecular formula C20H18F3N3O4S and a molecular weight of 453.44 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-4-(trifluoromethylsulfonyl)benzamide.
| Compound Name | N-[(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-4-(trifluoromethylsulfonyl)benzamide |
|---|---|
| PubChem CID | 46569284 |
| Molecular Formula | C20H18F3N3O4S |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | N-[(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-4-(trifluoromethylsulfonyl)benzamide |
| SMILES | COc1ccc(C(NC(=O)c2ccc(S(=O)(=O)C(F)(F)F)cc2)c2nccn2C)cc1 |
| InChI | InChI=1S/C20H18F3N3O4S/c1-26-12-11-24-18(26)17(13-3-7-15(30-2)8-4-13)25-19(27)14-5-9-16(10-6-14)31(28,29)20(21,22)23/h3-12,17H,1-2H3,(H,25,27) |
| InChIKey | YZBPANRFIDGFGS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |