C26H31N5O5 — CID 24625712
N-[(3,5-dimethoxyphenyl)-(1-methylimidazol-2-yl)methyl]-4-(3-methylpiperidin-1-yl)-3-nitrobenzamide (PubChem CID 24625712) has the molecular formula C26H31N5O5 and a molecular weight of 493.56 g/mol. Its IUPAC name is N-[(3,5-dimethoxyphenyl)-(1-methylimidazol-2-yl)methyl]-4-(3-methylpiperidin-1-yl)-3-nitrobenzamide.
| Compound Name | N-[(3,5-dimethoxyphenyl)-(1-methylimidazol-2-yl)methyl]-4-(3-methylpiperidin-1-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 24625712 |
| Molecular Formula | C26H31N5O5 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | N-[(3,5-dimethoxyphenyl)-(1-methylimidazol-2-yl)methyl]-4-(3-methylpiperidin-1-yl)-3-nitrobenzamide |
| SMILES | COc1cc(OC)cc(C(NC(=O)c2ccc(N3CCCC(C)C3)c([N+](=O)[O-])c2)c2nccn2C)c1 |
| InChI | InChI=1S/C26H31N5O5/c1-17-6-5-10-30(16-17)22-8-7-18(14-23(22)31(33)34)26(32)28-24(25-27-9-11-29(25)2)19-12-20(35-3)15-21(13-19)36-4/h7-9,11-15,17,24H,5-6,10,16H2,1-4H3,(H,28,32) |
| InChIKey | DCRCXPIQYXKWCH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 111.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|