C18H24ClN5O4 — CID 119665456
N-(1-aminohexan-2-yl)-6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide;hydrochloride (PubChem CID 119665456) has the molecular formula C18H24ClN5O4 and a molecular weight of 409.87 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119665456 |
| Molecular Formula | C18H24ClN5O4 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N-(1-aminohexan-2-yl)-6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide;hydrochloride |
| SMILES | CCCCC(CN)NC(=O)c1nn(-c2ccccc2[N+](=O)[O-])c(C)cc1=O.Cl |
| InChI | InChI=1S/C18H23N5O4.ClH/c1-3-4-7-13(11-19)20-18(25)17-16(24)10-12(2)22(21-17)14-8-5-6-9-15(14)23(26)27;/h5-6,8-10,13H,3-4,7,11,19H2,1-2H3,(H,20,25);1H |
| InChIKey | BJVNUBASVGWQNB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 133.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|