C16H19ClN4O2S — CID 55520784
2-chloro-N-[4-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-thiazol-2-yl]pyridine-4-carboxamide (PubChem CID 55520784) has the molecular formula C16H19ClN4O2S and a molecular weight of 366.87 g/mol. Its IUPAC name is 2-chloro-N-[4-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-thiazol-2-yl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[4-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-thiazol-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 55520784 |
| Molecular Formula | C16H19ClN4O2S |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 2-chloro-N-[4-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-thiazol-2-yl]pyridine-4-carboxamide |
| SMILES | CC1CN(Cc2csc(NC(=O)c3ccnc(Cl)c3)n2)CC(C)O1 |
| InChI | InChI=1S/C16H19ClN4O2S/c1-10-6-21(7-11(2)23-10)8-13-9-24-16(19-13)20-15(22)12-3-4-18-14(17)5-12/h3-5,9-11H,6-8H2,1-2H3,(H,19,20,22) |
| InChIKey | TVJGNAYAVVCHIO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|