C26H32N2O4 — CID 55677135
N-[2-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-3,4-dimethoxy-5-prop-2-enylbenzamide (PubChem CID 55677135) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is N-[2-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-3,4-dimethoxy-5-prop-2-enylbenzamide.
| Compound Name | N-[2-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-3,4-dimethoxy-5-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 55677135 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | N-[2-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-3,4-dimethoxy-5-prop-2-enylbenzamide |
| SMILES | C=CCc1cc(C(=O)Nc2ccccc2C(=O)N2CC(C)CC(C)C2)cc(OC)c1OC |
| InChI | InChI=1S/C26H32N2O4/c1-6-9-19-13-20(14-23(31-4)24(19)32-5)25(29)27-22-11-8-7-10-21(22)26(30)28-15-17(2)12-18(3)16-28/h6-8,10-11,13-14,17-18H,1,9,12,15-16H2,2-5H3,(H,27,29) |
| InChIKey | LRHQZDNVFRCDLG-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|