C26H25N3O5 — CID 126002279
3,4,5-trimethoxy-N-[2-[[(Z)-[(E)-3-phenylprop-2-enylidene]amino]carbamoyl]phenyl]benzamide (PubChem CID 126002279) has the molecular formula C26H25N3O5 and a molecular weight of 459.50 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[2-[[(Z)-[(E)-3-phenylprop-2-enylidene]amino]carbamoyl]phenyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[2-[[(Z)-[(E)-3-phenylprop-2-enylidene]amino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 126002279 |
| Molecular Formula | C26H25N3O5 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 3,4,5-trimethoxy-N-[2-[[(Z)-[(E)-3-phenylprop-2-enylidene]amino]carbamoyl]phenyl]benzamide |
| SMILES | COc1cc(C(=O)Nc2ccccc2C(=O)N/N=C\C=C\c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C26H25N3O5/c1-32-22-16-19(17-23(33-2)24(22)34-3)25(30)28-21-14-8-7-13-20(21)26(31)29-27-15-9-12-18-10-5-4-6-11-18/h4-17H,1-3H3,(H,28,30)(H,29,31)/b12-9+,27-15- |
| InChIKey | CZSTZHNUCGZLTK-SUQIKTCDSA-N |
| XLogP | 4.39 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|