C18H18N2O3 — CID 6824789
N-(cinnamylideneamino)-3,4-dimethoxybenzamide (PubChem CID 6824789) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is N-(cinnamylideneamino)-3,4-dimethoxybenzamide.
| Compound Name | N-(cinnamylideneamino)-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 6824789 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | N-(cinnamylideneamino)-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NN=CC=Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C18H18N2O3/c1-22-16-11-10-15(13-17(16)23-2)18(21)20-19-12-6-9-14-7-4-3-5-8-14/h3-13H,1-2H3,(H,20,21) |
| InChIKey | POSOTBPYTGBLMJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|