About 3-iodo-N'-(4-methylbenzoyl)benzohydrazide
3-iodo-N'-(4-methylbenzoyl)benzohydrazide (PubChem CID 1127160) has the molecular formula C15H13IN2O2
and a molecular weight of 380.19 g/mol. Its IUPAC name is 3-iodo-N'-(4-methylbenzoyl)benzohydrazide.
Molecular Properties
| Compound Name | 3-iodo-N'-(4-methylbenzoyl)benzohydrazide |
| PubChem CID | 1127160 |
| Molecular Formula | C15H13IN2O2 |
| Molecular Weight | 380.19 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | 3-iodo-N'-(4-methylbenzoyl)benzohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)c2cccc(I)c2)cc1 |
| InChI | InChI=1S/C15H13IN2O2/c1-10-5-7-11(8-6-10)14(19)17-18-15(20)12-3-2-4-13(16)9-12/h2-9H,1H3,(H,17,19)(H,18,20) |
| InChIKey | MRPYLCHXCAYKQG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.19 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-N'-(4-methylbenzoyl)benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-N'-(4-methylbenzoyl)benzohydrazide?
The IUPAC name of 3-iodo-N'-(4-methylbenzoyl)benzohydrazide (CID 1127160) is 3-iodo-N'-(4-methylbenzoyl)benzohydrazide.
What is the SMILES notation for 3-iodo-N'-(4-methylbenzoyl)benzohydrazide?
The canonical SMILES for 3-iodo-N'-(4-methylbenzoyl)benzohydrazide is Cc1ccc(C(=O)NNC(=O)c2cccc(I)c2)cc1.
What is the InChIKey of 3-iodo-N'-(4-methylbenzoyl)benzohydrazide?
The InChIKey is MRPYLCHXCAYKQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13IN2O2/c1-10-5-7-11(8-6-10)14(19)17-18-15(20)12-3-2-4-13(16)9-12/h2-9H,1H3,(H,17,19)(H,18,20).
What are the key properties of 3-iodo-N'-(4-methylbenzoyl)benzohydrazide?
3-iodo-N'-(4-methylbenzoyl)benzohydrazide has a molecular weight of 380.19 g/mol, XLogP of 2.67, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-N'-(4-methylbenzoyl)benzohydrazide is sourced from PubChem (CID 1127160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).