C17H18N2O2 — CID 7600084
2,4-dimethyl-N'-(3-methylbenzoyl)benzohydrazide (PubChem CID 7600084) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 2,4-dimethyl-N'-(3-methylbenzoyl)benzohydrazide.
| Compound Name | 2,4-dimethyl-N'-(3-methylbenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 7600084 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2,4-dimethyl-N'-(3-methylbenzoyl)benzohydrazide |
| SMILES | Cc1cccc(C(=O)NNC(=O)c2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C17H18N2O2/c1-11-5-4-6-14(10-11)16(20)18-19-17(21)15-8-7-12(2)9-13(15)3/h4-10H,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | PQXHFRVHMNHMGL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|