About N'-[4-(diethylaminomethyl)benzoyl]-2,4-dimethylbenzohydrazide
N'-[4-(diethylaminomethyl)benzoyl]-2,4-dimethylbenzohydrazide (PubChem CID 43069979) has the molecular formula C21H27N3O2
and a molecular weight of 353.47 g/mol. Its IUPAC name is N'-[4-(diethylaminomethyl)benzoyl]-2,4-dimethylbenzohydrazide.
Molecular Properties
| Compound Name | N'-[4-(diethylaminomethyl)benzoyl]-2,4-dimethylbenzohydrazide |
| PubChem CID | 43069979 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | N'-[4-(diethylaminomethyl)benzoyl]-2,4-dimethylbenzohydrazide |
| SMILES | CCN(CC)Cc1ccc(C(=O)NNC(=O)c2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C21H27N3O2/c1-5-24(6-2)14-17-8-10-18(11-9-17)20(25)22-23-21(26)19-12-7-15(3)13-16(19)4/h7-13H,5-6,14H2,1-4H3,(H,22,25)(H,23,26) |
| InChIKey | FFCSMRNLRGHKOI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[4-(diethylaminomethyl)benzoyl]-2,4-dimethylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[4-(diethylaminomethyl)benzoyl]-2,4-dimethylbenzohydrazide?
The IUPAC name of N'-[4-(diethylaminomethyl)benzoyl]-2,4-dimethylbenzohydrazide (CID 43069979) is N'-[4-(diethylaminomethyl)benzoyl]-2,4-dimethylbenzohydrazide.
What is the SMILES notation for N'-[4-(diethylaminomethyl)benzoyl]-2,4-dimethylbenzohydrazide?
The canonical SMILES for N'-[4-(diethylaminomethyl)benzoyl]-2,4-dimethylbenzohydrazide is CCN(CC)Cc1ccc(C(=O)NNC(=O)c2ccc(C)cc2C)cc1.
What is the InChIKey of N'-[4-(diethylaminomethyl)benzoyl]-2,4-dimethylbenzohydrazide?
The InChIKey is FFCSMRNLRGHKOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27N3O2/c1-5-24(6-2)14-17-8-10-18(11-9-17)20(25)22-23-21(26)19-12-7-15(3)13-16(19)4/h7-13H,5-6,14H2,1-4H3,(H,22,25)(H,23,26).
What are the key properties of N'-[4-(diethylaminomethyl)benzoyl]-2,4-dimethylbenzohydrazide?
N'-[4-(diethylaminomethyl)benzoyl]-2,4-dimethylbenzohydrazide has a molecular weight of 353.47 g/mol, XLogP of 3.22, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[4-(diethylaminomethyl)benzoyl]-2,4-dimethylbenzohydrazide is sourced from PubChem (CID 43069979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).