C20H22N2O2S2 — CID 9276788
N'-[4-(1,3-dithian-2-yl)benzoyl]-2,4-dimethylbenzohydrazide (PubChem CID 9276788) has the molecular formula C20H22N2O2S2 and a molecular weight of 386.54 g/mol. Its IUPAC name is N'-[4-(1,3-dithian-2-yl)benzoyl]-2,4-dimethylbenzohydrazide.
| Compound Name | N'-[4-(1,3-dithian-2-yl)benzoyl]-2,4-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 9276788 |
| Molecular Formula | C20H22N2O2S2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | N'-[4-(1,3-dithian-2-yl)benzoyl]-2,4-dimethylbenzohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)c2ccc(C3SCCCS3)cc2)c(C)c1 |
| InChI | InChI=1S/C20H22N2O2S2/c1-13-4-9-17(14(2)12-13)19(24)22-21-18(23)15-5-7-16(8-6-15)20-25-10-3-11-26-20/h4-9,12,20H,3,10-11H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | SGQYPBZBTBXALC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|