C15H12NOPS — CID 15426559
2-diphenylphosphoryl-1,3-thiazole (PubChem CID 15426559) has the molecular formula C15H12NOPS and a molecular weight of 285.31 g/mol. Its IUPAC name is 2-diphenylphosphoryl-1,3-thiazole.
| Compound Name | 2-diphenylphosphoryl-1,3-thiazole |
|---|---|
| PubChem CID | 15426559 |
| Molecular Formula | C15H12NOPS |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 2-diphenylphosphoryl-1,3-thiazole |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1nccs1 |
| InChI | InChI=1S/C15H12NOPS/c17-18(15-16-11-12-19-15,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12H |
| InChIKey | FOLXMHUEEJMLNE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|