C6H7N3OS — CID 146268564
2-(1,3-thiazol-2-yl)prop-2-enehydrazide (PubChem CID 146268564) has the molecular formula C6H7N3OS and a molecular weight of 169.21 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-yl)prop-2-enehydrazide.
| Compound Name | 2-(1,3-thiazol-2-yl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 146268564 |
| Molecular Formula | C6H7N3OS |
| Molecular Weight | 169.21 g/mol |
| Exact Mass | 169.03 |
| IUPAC Name | 2-(1,3-thiazol-2-yl)prop-2-enehydrazide |
| SMILES | C=C(C(=O)NN)c1nccs1 |
| InChI | InChI=1S/C6H7N3OS/c1-4(5(10)9-7)6-8-2-3-11-6/h2-3H,1,7H2,(H,9,10) |
| InChIKey | PQVJTGZCDWSZNS-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.21 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|