C7H6BrN3OS — CID 130678505
4-bromo-N-(1-cyanoethyl)-1,3-thiazole-2-carboxamide (PubChem CID 130678505) has the molecular formula C7H6BrN3OS and a molecular weight of 260.12 g/mol. Its IUPAC name is 4-bromo-N-(1-cyanoethyl)-1,3-thiazole-2-carboxamide.
| Compound Name | 4-bromo-N-(1-cyanoethyl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 130678505 |
| Molecular Formula | C7H6BrN3OS |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 258.94 |
| IUPAC Name | 4-bromo-N-(1-cyanoethyl)-1,3-thiazole-2-carboxamide |
| SMILES | CC(C#N)NC(=O)c1nc(Br)cs1 |
| InChI | InChI=1S/C7H6BrN3OS/c1-4(2-9)10-6(12)7-11-5(8)3-13-7/h3-4H,1H3,(H,10,12) |
| InChIKey | HNUMBCJYZOGOOR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |