C8H6Br2N4O3S2 — CID 160553562
4-bromo-1,3-thiazole-2-carbohydrazide;4-bromo-1,3-thiazole-2-carboxylic acid (PubChem CID 160553562) has the molecular formula C8H6Br2N4O3S2 and a molecular weight of 430.10 g/mol. Its IUPAC name is 4-bromo-1,3-thiazole-2-carbohydrazide;4-bromo-1,3-thiazole-2-carboxylic acid.
| Compound Name | 4-bromo-1,3-thiazole-2-carbohydrazide;4-bromo-1,3-thiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 160553562 |
| Molecular Formula | C8H6Br2N4O3S2 |
| Molecular Weight | 430.10 g/mol |
| Exact Mass | 427.82 |
| IUPAC Name | 4-bromo-1,3-thiazole-2-carbohydrazide;4-bromo-1,3-thiazole-2-carboxylic acid |
| SMILES | NNC(=O)c1nc(Br)cs1.O=C(O)c1nc(Br)cs1 |
| InChI | InChI=1S/C4H4BrN3OS.C4H2BrNO2S/c5-2-1-10-4(7-2)3(9)8-6;5-2-1-9-3(6-2)4(7)8/h1H,6H2,(H,8,9);1H,(H,7,8) |
| InChIKey | QYJQFTCUEXIBTK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.10 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|