4-(2,2-difluoroethylcarbamoyl)-1,3-thiazole-2-carboxylic acid

C7H6F2N2O3S — CID 104892941

IUPAC4-(2,2-difluoroethylcarbamoyl)-1,3-thiazole-2-carboxylic acid
SMILESO=C(NCC(F)F)c1csc(C(=O)O)n1
InChIInChI=1S/C7H6F2N2O3S/c8-4(9)1-10-5(12)3-2-15-6(11-3)7(13)14/h2,4H,1H2,(H,10,12)(H,13,14)
InChIKeyKQFCOKWEBXIFRL-UHFFFAOYSA-N
MW236.20 g/mol
LogP0.84
Rot. Bonds4

About 4-(2,2-difluoroethylcarbamoyl)-1,3-thiazole-2-carboxylic acid

4-(2,2-difluoroethylcarbamoyl)-1,3-thiazole-2-carboxylic acid (PubChem CID 104892941) has the molecular formula C7H6F2N2O3S and a molecular weight of 236.20 g/mol. Its IUPAC name is 4-(2,2-difluoroethylcarbamoyl)-1,3-thiazole-2-carboxylic acid.

Molecular Properties

Compound Name4-(2,2-difluoroethylcarbamoyl)-1,3-thiazole-2-carboxylic acid
PubChem CID104892941
Molecular FormulaC7H6F2N2O3S
Molecular Weight236.20 g/mol
Exact Mass236.01
IUPAC Name4-(2,2-difluoroethylcarbamoyl)-1,3-thiazole-2-carboxylic acid
SMILESO=C(NCC(F)F)c1csc(C(=O)O)n1
InChIInChI=1S/C7H6F2N2O3S/c8-4(9)1-10-5(12)3-2-15-6(11-3)7(13)14/h2,4H,1H2,(H,10,12)(H,13,14)
InChIKeyKQFCOKWEBXIFRL-UHFFFAOYSA-N
XLogP0.84
TPSA79.29 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.20
LogP ≤ 50.84
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-(2,2-difluoroethylcarbamoyl)-1,3-thiazole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,2-difluoroethylcarbamoyl)-1,3-thiazole-2-carboxylic acid?
The IUPAC name of 4-(2,2-difluoroethylcarbamoyl)-1,3-thiazole-2-carboxylic acid (CID 104892941) is 4-(2,2-difluoroethylcarbamoyl)-1,3-thiazole-2-carboxylic acid.
What is the SMILES notation for 4-(2,2-difluoroethylcarbamoyl)-1,3-thiazole-2-carboxylic acid?
The canonical SMILES for 4-(2,2-difluoroethylcarbamoyl)-1,3-thiazole-2-carboxylic acid is O=C(NCC(F)F)c1csc(C(=O)O)n1.
What is the InChIKey of 4-(2,2-difluoroethylcarbamoyl)-1,3-thiazole-2-carboxylic acid?
The InChIKey is KQFCOKWEBXIFRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F2N2O3S/c8-4(9)1-10-5(12)3-2-15-6(11-3)7(13)14/h2,4H,1H2,(H,10,12)(H,13,14).
What are the key properties of 4-(2,2-difluoroethylcarbamoyl)-1,3-thiazole-2-carboxylic acid?
4-(2,2-difluoroethylcarbamoyl)-1,3-thiazole-2-carboxylic acid has a molecular weight of 236.20 g/mol, XLogP of 0.84, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-difluoroethylcarbamoyl)-1,3-thiazole-2-carboxylic acid is sourced from PubChem (CID 104892941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).