C8H7F3N2O2 — CID 176996036
N-(2,2-difluoroethyl)-6-fluoro-5-hydroxypyridine-2-carboxamide (PubChem CID 176996036) has the molecular formula C8H7F3N2O2 and a molecular weight of 220.15 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-6-fluoro-5-hydroxypyridine-2-carboxamide.
| Compound Name | N-(2,2-difluoroethyl)-6-fluoro-5-hydroxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 176996036 |
| Molecular Formula | C8H7F3N2O2 |
| Molecular Weight | 220.15 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | N-(2,2-difluoroethyl)-6-fluoro-5-hydroxypyridine-2-carboxamide |
| SMILES | O=C(NCC(F)F)c1ccc(O)c(F)n1 |
| InChI | InChI=1S/C8H7F3N2O2/c9-6(10)3-12-8(15)4-1-2-5(14)7(11)13-4/h1-2,6,14H,3H2,(H,12,15) |
| InChIKey | KLTACTWGFHFNGI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.15 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|