C17H23F3N4O — CID 169148875
N-(2,2-difluoroethyl)-6-fluoro-5-(4-pyrrolidin-1-ylpiperidin-1-yl)pyridine-2-carboxamide (PubChem CID 169148875) has the molecular formula C17H23F3N4O and a molecular weight of 356.39 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-6-fluoro-5-(4-pyrrolidin-1-ylpiperidin-1-yl)pyridine-2-carboxamide.
| Compound Name | N-(2,2-difluoroethyl)-6-fluoro-5-(4-pyrrolidin-1-ylpiperidin-1-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 169148875 |
| Molecular Formula | C17H23F3N4O |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | N-(2,2-difluoroethyl)-6-fluoro-5-(4-pyrrolidin-1-ylpiperidin-1-yl)pyridine-2-carboxamide |
| SMILES | O=C(NCC(F)F)c1ccc(N2CCC(N3CCCC3)CC2)c(F)n1 |
| InChI | InChI=1S/C17H23F3N4O/c18-15(19)11-21-17(25)13-3-4-14(16(20)22-13)24-9-5-12(6-10-24)23-7-1-2-8-23/h3-4,12,15H,1-2,5-11H2,(H,21,25) |
| InChIKey | KOYZZENHGQZHJQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|