C21H33ClN4O — CID 176748297
5-[4-(3-tert-butylpiperidin-1-yl)piperidin-1-yl]-6-chloro-N-methylpyridine-2-carboxamide (PubChem CID 176748297) has the molecular formula C21H33ClN4O and a molecular weight of 392.98 g/mol. Its IUPAC name is 5-[4-(3-tert-butylpiperidin-1-yl)piperidin-1-yl]-6-chloro-N-methylpyridine-2-carboxamide.
| Compound Name | 5-[4-(3-tert-butylpiperidin-1-yl)piperidin-1-yl]-6-chloro-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 176748297 |
| Molecular Formula | C21H33ClN4O |
| Molecular Weight | 392.98 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 5-[4-(3-tert-butylpiperidin-1-yl)piperidin-1-yl]-6-chloro-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1ccc(N2CCC(N3CCCC(C(C)(C)C)C3)CC2)c(Cl)n1 |
| InChI | InChI=1S/C21H33ClN4O/c1-21(2,3)15-6-5-11-26(14-15)16-9-12-25(13-10-16)18-8-7-17(20(27)23-4)24-19(18)22/h7-8,15-16H,5-6,9-14H2,1-4H3,(H,23,27) |
| InChIKey | GCLVVRIXKVQJSP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.98 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|